EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O5 |
| Net Charge | 0 |
| Average Mass | 374.477 |
| Monoisotopic Mass | 374.20932 |
| SMILES | CC(=O)[C@H]1CC[C@H]2C3=CC(=O)C([C@H](C)O)=C(C)[C@@]3(CCC(=O)O)CC[C@]12C |
| InChI | InChI=1S/C22H30O5/c1-12-20(14(3)24)18(25)11-17-16-6-5-15(13(2)23)21(16,4)9-10-22(12,17)8-7-19(26)27/h11,14-16,24H,5-10H2,1-4H3,(H,26,27)/t14-,15+,16-,21+,22+/m0/s1 |
| InChIKey | MHBCQMRLJQUUKQ-OFQQUKTFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulisporiumspecies (ncbitaxon:1897413) | - | DOI (10.1016/j.tet.2018.08.011) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Abeo-nodulisporisteroid A (CHEBI:211511) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| 3-[(3S,3aS,5aR,9bR)-3-acetyl-7-[(1S)-1-hydroxyethyl]-3a,6-dimethyl-8-oxo-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-5a-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439196 | ChemSpider |