EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O8 |
| Net Charge | 0 |
| Average Mass | 506.636 |
| Monoisotopic Mass | 506.28797 |
| SMILES | COc1c(C)c(OC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)c2c(c1C(=O)O)[C@@H](OC)O[C@H]2OC |
| InChI | InChI=1S/C28H42O8/c1-15-21(32-6)19(23(29)30)18-20(25(34-8)36-24(18)33-7)22(15)35-14-17-27(4)12-9-11-26(2,3)16(27)10-13-28(17,5)31/h16-17,24-25,31H,9-14H2,1-8H3,(H,29,30)/t16-,17+,24-,25+,27-,28+/m0/s1 |
| InChIKey | XPNNJVKLBKAGMX-ODGCFDFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypoxylon (ncbitaxon:42308) | - | PubMed (31476402) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fendleric acid A (CHEBI:211502) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| (1R,3S)-7-[[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-1,3,5-trimethoxy-6-methyl-1,3-dihydro-2-benzouran-4-carboxylic acid |