EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O7 |
| Net Charge | 0 |
| Average Mass | 302.283 |
| Monoisotopic Mass | 302.11140 |
| SMILES | COC1=C(NCC(=O)O)C[C@](O)(CO)CC1=NCC(=O)O |
| InChI | InChI=1S/C12H18N2O7/c1-21-11-7(13-4-9(16)17)2-12(20,6-15)3-8(11)14-5-10(18)19/h13,15,20H,2-6H2,1H3,(H,16,17)(H,18,19)/t12-/m1/s1 |
| InChIKey | NCZZDMCBYGVEGP-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | PubMed (16630254) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mycosporine-2-glycine (CHEBI:211486) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-[[3-(carboxymethylimino)-5-hydroxy-5-(hydroxymethyl)-2-methoxycyclohexen-1-yl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 123959990 | ChemSpider |