EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O8 |
| Net Charge | 0 |
| Average Mass | 490.593 |
| Monoisotopic Mass | 490.25667 |
| SMILES | COC(=O)c1c(OC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)c(C)c(OC)c2c1C(O)OC2=O |
| InChI | InChI=1S/C27H38O8/c1-14-20(32-6)18-17(23(29)35-24(18)30)19(22(28)33-7)21(14)34-13-16-26(4)11-8-10-25(2,3)15(26)9-12-27(16,5)31/h15-16,23,29,31H,8-13H2,1-7H3/t15-,16+,23?,26-,27+/m0/s1 |
| InChIKey | JTZRGALJGAWNLX-GRFPXVQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypoxylon (ncbitaxon:42308) | - | PubMed (31476402) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fendlerin C (CHEBI:211482) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| methyl 5-[[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-3-hydroxy-7-methoxy-6-methyl-1-oxo-3H-2-benzouran-4-carboxylate |