EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39NO4 |
| Net Charge | 0 |
| Average Mass | 429.601 |
| Monoisotopic Mass | 429.28791 |
| SMILES | CCC(C)[C@@H]1C(=O)/C(=C(/O)[C@H]2[C@H]3[C@H](C=C(C)[C@@H]2[C@]2(C)O[C@H]2C)CCC[C@@H]3C)C(=O)N1C |
| InChI | InChI=1S/C26H39NO4/c1-8-13(2)22-24(29)20(25(30)27(22)7)23(28)19-18-14(3)10-9-11-17(18)12-15(4)21(19)26(6)16(5)31-26/h12-14,16-19,21-22,28H,8-11H2,1-7H3/b23-20-/t13?,14-,16-,17-,18+,19-,21-,22+,26+/m0/s1 |
| InChIKey | HQUZDIJDDVGVJA-NTOPCHQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichobotrys (ncbitaxon:1520156) | - | DOI (10.1016/j.tet.2015.10.010) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichobotrysin A (CHEBI:211474) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| (3Z,5R)-3-[[(1S,2R,4aR,8S,8aR)-2-[(2S,3S)-2,3-dimethyloxiran-2-yl]-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-hydroxymethylidene]-5-butan-2-yl-1-methylpyrrolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 40256684 | ChemSpider |