EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO2 |
| Net Charge | 0 |
| Average Mass | 127.143 |
| Monoisotopic Mass | 127.06333 |
| SMILES | C=C/C=C\[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H9NO2/c1-2-3-4-5(7)6(8)9/h2-5H,1,7H2,(H,8,9)/b4-3-/t5-/m0/s1 |
| InChIKey | LAVTULVXLBWEBX-XUELKZDXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clavulinopsis helvola (ncbitaxon:2872525) | - | DOI (10.1016/s0031-9422(97)00396-8) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D,L-2-amino-3(cis),5-hexadienoic acid (CHEBI:211462) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (3Z)-2-aminohexa-3,5-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 67155746 | ChemSpider |