EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O8 |
| Net Charge | 0 |
| Average Mass | 396.436 |
| Monoisotopic Mass | 396.17842 |
| SMILES | C[C@@H](CCC[C@@H]1Cc2c(O)ccc(O)c2C(=O)O1)OC(=O)C[C@](C)(O)CCO |
| InChI | InChI=1S/C20H28O8/c1-12(27-17(24)11-20(2,26)8-9-21)4-3-5-13-10-14-15(22)6-7-16(23)18(14)19(25)28-13/h6-7,12-13,21-23,26H,3-5,8-11H2,1-2H3/t12-,13+,20+/m0/s1 |
| InChIKey | YLGGKUNRZWXPJM-MRRFBWAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (31921029) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergimarin C (CHEBI:211450) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| [(2S)-5-[(3R)-5,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl]pentan-2-yl] (3R)-3,5-dihydroxy-3-methylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 81363684 | ChemSpider |