EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O8 |
| Net Charge | 0 |
| Average Mass | 366.366 |
| Monoisotopic Mass | 366.13147 |
| SMILES | C[C@@H](CCC[C@@H]1Cc2c(O)ccc(O)c2C(=O)O1)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C18H22O8/c1-10(25-16(23)8-7-15(21)22)3-2-4-11-9-12-13(19)5-6-14(20)17(12)18(24)26-11/h5-6,10-11,19-20H,2-4,7-9H2,1H3,(H,21,22)/t10-,11+/m0/s1 |
| InChIKey | KTEFRIADHWTBQB-WDEREUQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (31921029) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergimarin B (CHEBI:211443) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 4-[(2S)-5-[(3R)-5,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl]pentan-2-yl]oxy-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 81363683 | ChemSpider |