EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O7 |
| Net Charge | 0 |
| Average Mass | 460.567 |
| Monoisotopic Mass | 460.24610 |
| SMILES | COc1c(C)c(OC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)c2c(c1C(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C26H36O7/c1-14-20(15-12-33-23(29)18(15)19(22(27)28)21(14)31-6)32-13-17-25(4)10-7-9-24(2,3)16(25)8-11-26(17,5)30/h16-17,30H,7-13H2,1-6H3,(H,27,28)/t16-,17+,25-,26+/m0/s1 |
| InChIKey | VZJCTOKVNRVWQZ-IMCRMFDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypoxylon (ncbitaxon:42308) | - | PubMed (31476402) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fendleric acid C (CHEBI:211439) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 7-[[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-5-methoxy-6-methyl-3-oxo-1H-2-benzouran-4-carboxylic acid |