EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O3 |
| Net Charge | 0 |
| Average Mass | 420.593 |
| Monoisotopic Mass | 420.26645 |
| SMILES | C/C(=C\[C@H]1OC(=O)[C@H](C)[C@@H]1C)[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H36O3/c1-16(14-25-17(2)18(3)26(30)31-25)22-8-9-23-21-7-6-19-15-20(29)10-12-27(19,4)24(21)11-13-28(22,23)5/h6-7,14-15,17-18,22,24-25H,8-13H2,1-5H3/b16-14+/t17-,18+,22+,24-,25+,27-,28+/m0/s1 |
| InChIKey | CNHFRXHEHHVMLU-KUXYOVDPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium janthinellum (ncbitaxon:5079) | - | PubMed (30891440) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penijanthoid A (CHEBI:211375) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (3R,4S,5S)-5-[(E)-2-[(9R,10R,13R,17R)-10,13-dimethyl-3-oxo-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]prop-1-enyl]-3,4-dimethyloxolan-2-one |
| Manual Xrefs | Databases |
|---|---|
| 71266930 | ChemSpider |