EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H49N7O7 |
| Net Charge | 0 |
| Average Mass | 619.764 |
| Monoisotopic Mass | 619.36935 |
| SMILES | CC(C)CCC/C=C\CCCCCCCC(=O)NCC(=O)N[C@@H]1[C@@H](O)[C@@H](O)C(Nc2ncnc3ncnc23)O[C@H]1[C@@H](O)CO |
| InChI | InChI=1S/C30H49N7O7/c1-19(2)13-11-9-7-5-3-4-6-8-10-12-14-21(40)31-15-22(41)36-23-25(42)26(43)30(44-27(23)20(39)16-38)37-29-24-28(33-17-32-24)34-18-35-29/h5,7,17-20,23,25-27,30,38-39,42-43H,3-4,6,8-16H2,1-2H3,(H,31,40)(H,36,41)(H2,32,33,34,35,37)/b7-5-/t20-,23+,25+,26+,27-,30?/m0/s1 |
| InChIKey | MHXSLJSEZYHPNN-TYCKKTRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (16060384) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anicemycin (CHEBI:211360) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (Z)-N-[2-[[(2R,3R,4R,5R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dihydroxy-6-(7H-purin-6-ylamino)oxan-3-yl]amino]-2-oxoethyl]-14-methylpentadec-9-enamide |
| Manual Xrefs | Databases |
|---|---|
| 78438517 | ChemSpider |