EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27N3O3 |
| Net Charge | 0 |
| Average Mass | 285.388 |
| Monoisotopic Mass | 285.20524 |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C14H27N3O3/c1-6-9(4)12(16-10(5)18)14(20)17-11(13(15)19)7-8(2)3/h8-9,11-12H,6-7H2,1-5H3,(H2,15,19)(H,16,18)(H,17,20)/t9-,11-,12-/m0/s1 |
| InChIKey | TXPWUMZDOQMDFF-DLOVCJGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.tet.2018.03.028) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-isoleucine-L-leucinamide (CHEBI:211310) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S,3S)-2-acetamido-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-3-methylpentanamide |
| Manual Xrefs | Databases |
|---|---|
| 71048946 | ChemSpider |