EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H44N4O13 |
| Net Charge | 0 |
| Average Mass | 740.763 |
| Monoisotopic Mass | 740.29049 |
| SMILES | O=C(CC(O)(CC(=O)N[C@@H](CCCCN(O)C(=O)/C=C/c1ccccc1)C(=O)O)C(=O)O)N[C@@H](CCCCN(O)C(=O)/C=C/c1ccccc1)C(=O)O |
| InChI | InChI=1S/C36H44N4O13/c41-29(37-27(33(45)46)15-7-9-21-39(52)31(43)19-17-25-11-3-1-4-12-25)23-36(51,35(49)50)24-30(42)38-28(34(47)48)16-8-10-22-40(53)32(44)20-18-26-13-5-2-6-14-26/h1-6,11-14,17-20,27-28,51-53H,7-10,15-16,21-24H2,(H,37,41)(H,38,42)(H,45,46)(H,47,48)(H,49,50)/b19-17+,20-18+/t27-,28-/m0/s1 |
| InChIKey | NJZHNIXLUZOOST-KIPNRVANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nannocystis (ncbitaxon:53) | - | PubMed (1556005) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nannochelin C (CHEBI:211290) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| 4-[[(1S)-1-carboxy-5-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]pentyl]amino]-2-[2-[[(1S)-1-carboxy-5-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]pentyl]amino]-2-oxoethyl]-2-hydroxy-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 20144000 | ChemSpider |