EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O6 |
| Net Charge | 0 |
| Average Mass | 386.444 |
| Monoisotopic Mass | 386.17294 |
| SMILES | CC1CCCC[C@H]2C(=O)CC[C@H]3OC(/C=C/C=C/C=C/C(=O)O)=C(C(=O)O1)[C@@H]32 |
| InChI | InChI=1S/C22H26O6/c1-14-8-6-7-9-15-16(23)12-13-18-20(15)21(22(26)27-14)17(28-18)10-4-2-3-5-11-19(24)25/h2-5,10-11,14-15,18,20H,6-9,12-13H2,1H3,(H,24,25)/b3-2+,10-4+,11-5+/t14?,15-,18+,20+/m0/s1 |
| InChIKey | FXWZJHIHNQQRDJ-XGCDNSQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus neoglaber (ncbitaxon:41049) | - | PubMed (19343064) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glabramycin B (CHEBI:211135) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-[(1R,12R,16S)-6-methyl-8,15-dioxo-7,11-dioxatricyclo[7.6.1.012,16]hexadec-9-en-10-yl]hepta-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 34552224 | ChemSpider |