EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42N6O6 |
| Net Charge | 0 |
| Average Mass | 546.669 |
| Monoisotopic Mass | 546.31658 |
| SMILES | CC1OC2=N[C@@H]1C(=O)N[C@@H](C(C)C)C1=N[C@H](C(=O)N[C@@H](C(C)C)C3=N[C@H](C(=O)N[C@H]2C(C)C)C(C)O3)C(C)O1 |
| InChI | InChI=1S/C27H42N6O6/c1-10(2)16-25-31-20(13(7)37-25)23(35)29-18(12(5)6)27-33-21(15(9)39-27)24(36)30-17(11(3)4)26-32-19(14(8)38-26)22(34)28-16/h10-21H,1-9H3,(H,28,34)(H,29,35)(H,30,36)/t13?,14?,15?,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | MIDTUAMKJJDHAR-UYZKKHLLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Westiellopsis prolifica (ncbitaxon:221298) | - | PubMed (1602299) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Westielamide (CHEBI:211089) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (1S,4S,8S,11S,15S,18S)-7,14,21-trimethyl-4,11,18-tri(propan-2-yl)-6,13,20-trioxa-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-5(24),12(23),19(22)-triene-2,9,16-trione |
| Manual Xrefs | Databases |
|---|---|
| 78445415 | ChemSpider |