EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31NO8 |
| Net Charge | 0 |
| Average Mass | 485.533 |
| Monoisotopic Mass | 485.20497 |
| SMILES | C[C@@H]1[C@@H](Nc2ccccc2C(=O)O)[C@@H](C)C(=O)[C@@H](C)[C@@H](O)[C@@H](C)C(=O)O[C@@H]1c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C26H31NO8/c1-12-21(27-20-8-6-5-7-19(20)25(32)33)13(2)24(16-9-17(28)11-18(29)10-16)35-26(34)15(4)23(31)14(3)22(12)30/h5-15,21,23-24,27-29,31H,1-4H3,(H,32,33)/t12-,13-,14-,15-,21+,23-,24+/m1/s1 |
| InChIKey | CWHSFNZCFPVDOB-PHVYJYCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharothrix (ncbitaxon:2071) | - | PubMed (25869768) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saccharothriolide A (CHEBI:211052) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-[[(2S,3R,4R,5R,7S,8R,9R)-2-(3,5-dihydroxyphenyl)-8-hydroxy-3,5,7,9-tetramethyl-6,10-dioxooxecan-4-yl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437433 | ChemSpider |