EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16O9 |
| Net Charge | 0 |
| Average Mass | 424.361 |
| Monoisotopic Mass | 424.07943 |
| SMILES | O=C(O)/C(=C\c1ccc(O)c(O)c1)c1c(O)cc(/C=C/c2ccc(O)c(O)c2)oc1=O |
| InChI | InChI=1S/C22H16O9/c23-15-5-2-11(8-17(15)25)1-4-13-10-19(27)20(22(30)31-13)14(21(28)29)7-12-3-6-16(24)18(26)9-12/h1-10,23-27H,(H,28,29)/b4-1+,14-7- |
| InChIKey | HODNKSQSWYYPLV-IHRVKPHJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanghuangporus baumii (ncbitaxon:108892) | - | PubMed (21531558) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phellibaumin D (CHEBI:211034) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (Z)-3-(3,4-dihydroxyphenyl)-2-[6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-2-oxopyran-3-yl]prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 26336826 | ChemSpider |