EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O6S2 |
| Net Charge | 0 |
| Average Mass | 426.516 |
| Monoisotopic Mass | 426.09193 |
| SMILES | O=C1CC[C@H](O)[C@H]2[C@@H]1C[C@@]13SS[C@]4(C[C@H]5[C@@H]([C@@H](O)CC[C@@H]5O)N4C1=O)C(=O)N23 |
| InChI | InChI=1S/C18H22N2O6S2/c21-9-1-3-11(23)13-7(9)5-17-15(25)20-14-8(10(22)2-4-12(14)24)6-18(20,28-27-17)16(26)19(13)17/h7-9,11-14,21,23-24H,1-6H2/t7-,8-,9+,11+,12+,13+,14-,17-,18-/m1/s1 |
| InChIKey | ZJUQZCAFDJFOTB-SFCFVZBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epicoccum nigrum (ncbitaxon:105696) | - | PubMed (20550196) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epicoccin T (CHEBI:211014) is a 2,5-diketopiperazines (CHEBI:65061) |
| Epicoccin T (CHEBI:211014) is a indoles (CHEBI:24828) |
| Epicoccin T (CHEBI:211014) is a organic disulfide (CHEBI:35489) |
| Epicoccin T (CHEBI:211014) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1R,4R,5S,9S,11R,14S,15S,18S,19S)-5,15,18-trihydroxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docosane-2,8,12-trione |