EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O5 |
| Net Charge | 0 |
| Average Mass | 268.309 |
| Monoisotopic Mass | 268.13107 |
| SMILES | CCCCOC(=O)CCC(=O)c1ccc([C@@H](C)O)o1 |
| InChI | InChI=1S/C14H20O5/c1-3-4-9-18-14(17)8-5-11(16)13-7-6-12(19-13)10(2)15/h6-7,10,15H,3-5,8-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | MUODHDJZQZKAKK-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diaporthespecies XZ-07 (ncbitaxon:357840) | - | DOI (10.1002/hlca.200800416) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Butyl 5-[(1R)-1-hydroxyethyl]-gamma-oxofuran-2-butanoate (CHEBI:211011) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| butyl 4-[5-[(1R)-1-hydroxyethyl]uran-2-yl]-4-oxobutanoate |
| Manual Xrefs | Databases |
|---|---|
| 78441309 | ChemSpider |