EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@H](O)C(=O)CO |
| WURCS | WURCS=2.0/1,1,0/[A122Oh]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)/t3-,4-,5+/m1/s1 |
| InChIKey | IZSRJDGCGRAUAR-WDCZJNDASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tagaturonic acid (CHEBI:21099) is a tagaturonic acid (CHEBI:26845) |
| D-tagaturonic acid (CHEBI:21099) is conjugate acid of D-tagaturonate (CHEBI:17886) |
| Incoming Relation(s) |
| D-tagaturonate (CHEBI:17886) is conjugate base of D-tagaturonic acid (CHEBI:21099) |
| IUPAC Name |
|---|
| D-arabino-hex-5-ulosonic acid |