EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H42N6O18 |
| Net Charge | 0 |
| Average Mass | 882.789 |
| Monoisotopic Mass | 882.25556 |
| SMILES | C/C=C(\NC(=O)CNC(=O)c1cccc(O)c1O)C(=O)O[C@H](C)[C@H](NC(=O)CNC(=O)c1cccc(O)c1O)C(=O)O[C@H](C)[C@H](NC(=O)CNC(=O)c1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C39H42N6O18/c1-4-22(43-26(49)14-40-34(55)19-8-5-11-23(46)31(19)52)38(60)62-18(3)30(45-28(51)16-42-36(57)21-10-7-13-25(48)33(21)54)39(61)63-17(2)29(37(58)59)44-27(50)15-41-35(56)20-9-6-12-24(47)32(20)53/h4-13,17-18,29-30,46-48,52-54H,14-16H2,1-3H3,(H,40,55)(H,41,56)(H,42,57)(H,43,49)(H,44,50)(H,45,51)(H,58,59)/b22-4-/t17-,18-,29+,30+/m1/s1 |
| InChIKey | PVVZJVCYKGHEJK-ADHBOQDSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus (ncbitaxon:1386) | - | DOI (10.1016/j.tet.2017.07.007) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tribenglthin A (CHEBI:210988) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[2-[(2,3-dihydroxybenzoyl)amino]acetyl]amino]-3-[(2S,3R)-2-[[2-[(2,3-dihydroxybenzoyl)amino]acetyl]amino]-3-[(Z)-2-[[2-[(2,3-dihydroxybenzoyl)amino]acetyl]amino]but-2-enoyl]oxybutanoyl]oxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62233317 | ChemSpider |