EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:210957 - fischerindole L
| Formula | C21H23ClN2 |
| Net Charge | 0 |
| Average Mass | 338.882 |
| Monoisotopic Mass | 338.15498 |
| SMILES | [H][C@]12c3c(nc4ccccc34)C(C)(C)[C@@]1([H])C[C@@H](Cl)[C@@](C)(C=C)[C@@H]2[N+]#[C-] |
| InChI | InChI=1S/C21H23ClN2/c1-6-21(4)15(22)11-13-17(19(21)23-5)16-12-9-7-8-10-14(12)24-18(16)20(13,2)3/h6-10,13,15,17,19,24H,1,11H2,2-4H3/t13-,15+,17+,19+,21+/m0/s1 |
| InChIKey | ADPQVXWEVQETCB-NFUAGSSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerella muscicola (ncbitaxon:92938) | - | DOI (10.1016/s0040-4039(00)92061-6) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fischerindole L (CHEBI:210957) has role bacterial metabolite (CHEBI:76969) |
| fischerindole L (CHEBI:210957) is a fischerindole alkaloid (CHEBI:141619) |
| fischerindole L (CHEBI:210957) is a isocyanide (CHEBI:35353) |
| fischerindole L (CHEBI:210957) is a olefinic compound (CHEBI:78840) |
| fischerindole L (CHEBI:210957) is a organic heterotetracyclic compound (CHEBI:38163) |
| fischerindole L (CHEBI:210957) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| (6aS,8R,9S,10R,10aR)-8-chloro-9-ethenyl-10-isocyano-6,6,9-trimethyl-5,6,6a,7,8,9,10,10a-octahydroindeno[2,1-b]indole |
| Citations |
|---|