EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO5 |
| Net Charge | 0 |
| Average Mass | 251.238 |
| Monoisotopic Mass | 251.07937 |
| SMILES | COC(=O)[C@@H](NC(C)=O)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H13NO5/c1-7(14)13-10(12(17)18-2)11(16)8-3-5-9(15)6-4-8/h3-6,10,15H,1-2H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | KEEDKENHSWAXTE-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phoma (ncbitaxon:37463) | - | DOI (10.1016/j.tet.2017.06.025) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phomarosine A (CHEBI:210955) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)-3-oxopropanoate |
| Manual Xrefs | Databases |
|---|---|
| 78439172 | ChemSpider |