EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | C=C1C[C@@]23C=CC(=O)[C@@](C)(CCC[C@H](C)C(=O)O)[C@@H]2C[C@@H]1CC3 |
| InChI | InChI=1S/C20H28O3/c1-13(18(22)23)5-4-8-19(3)16-11-15-6-9-20(16,12-14(15)2)10-7-17(19)21/h7,10,13,15-16H,2,4-6,8-9,11-12H2,1,3H3,(H,22,23)/t13-,15-,16-,19-,20+/m0/s1 |
| InChIKey | OTSJYWFBWZYZTG-UTAYDHNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (23157615) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Platencin SL5 (CHEBI:210945) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2S)-2-methyl-5-[(1S,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoic acid |