EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2OS2 |
| Net Charge | 0 |
| Average Mass | 312.419 |
| Monoisotopic Mass | 312.03911 |
| SMILES | CSc1ccc2c3ccnc4c(SC)cc(=O)n(c2c1)c43 |
| InChI | InChI=1S/C16H12N2OS2/c1-20-9-3-4-10-11-5-6-17-15-13(21-2)8-14(19)18(16(11)15)12(10)7-9/h3-8H,1-2H3 |
| InChIKey | OZQSTJALGHHVKK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pulveroboletus curtisii (ncbitaxon:279516) | - | DOI (10.1002/ejoc.200400519) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(Methylthio)canthin-6-one (CHEBI:210931) is a alkaloid (CHEBI:22315) |
| 9-(Methylthio)canthin-6-one (CHEBI:210931) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 4,13-bis(methylsulanyl)-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78436015 | ChemSpider |