EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | CC(=O)OC[C@H]1C[C@@H](C)[C@@H]2[C@@H](/C=C/C=C/C(=O)O)[C@@H](C)C=C[C@H]2C1 |
| InChI | InChI=1S/C20H28O4/c1-13-8-9-17-11-16(12-24-15(3)21)10-14(2)20(17)18(13)6-4-5-7-19(22)23/h4-9,13-14,16-18,20H,10-12H2,1-3H3,(H,22,23)/b6-4+,7-5+/t13-,14+,16-,17-,18-,20-/m0/s1 |
| InChIKey | FNGOIISIZQTTTM-WFJHGLDVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (26055397) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid N (CHEBI:210902) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,2S,4aR,6S,8R,8aS)-6-(acetyloxymethyl)-2,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35517050 | ChemSpider |