EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O7 |
| Net Charge | 0 |
| Average Mass | 270.237 |
| Monoisotopic Mass | 270.07395 |
| SMILES | C=C(O[C@@H]1C=C(C(=O)OC)[C@H]2O[C@H]2[C@H]1O)C(=O)OC |
| InChI | InChI=1S/C12H14O7/c1-5(11(14)16-2)18-7-4-6(12(15)17-3)9-10(19-9)8(7)13/h4,7-10,13H,1H2,2-3H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | XDDVCQKECCSPCY-RGOKHQFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clitocybe (ncbitaxon:50966) | - | DOI (10.1016/s0040-4020(01)87202-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyathiformine A (CHEBI:210812) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| methyl (1R,4R,5S,6S)-5-hydroxy-4-(3-methoxy-3-oxoprop-1-en-2-yl)oxy-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 8260012 | ChemSpider |