EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO4 |
| Net Charge | 0 |
| Average Mass | 251.282 |
| Monoisotopic Mass | 251.11576 |
| SMILES | Cc1cccc(O)c1C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C13H17NO4/c1-7(2)11(13(17)18)14-12(16)10-8(3)5-4-6-9(10)15/h4-7,11,15H,1-3H3,(H,14,16)(H,17,18)/t11-/m0/s1 |
| InChIKey | IJYABWXHQIIBHZ-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | PubMed (24499327) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cladosin E (CHEBI:210799) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-2-[(2-hydroxy-6-methylbenzoyl)amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 32674710 | ChemSpider |