EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O3 |
| Net Charge | 0 |
| Average Mass | 298.342 |
| Monoisotopic Mass | 298.13174 |
| SMILES | C=C(C)/C=C/c1cccc2c(C/C(=N/O)C(=O)OC)cnc12 |
| InChI | InChI=1S/C17H18N2O3/c1-11(2)7-8-12-5-4-6-14-13(10-18-16(12)14)9-15(19-21)17(20)22-3/h4-8,10,18,21H,1,9H2,2-3H3/b8-7+,19-15- |
| InChIKey | DXWANSGMSJGOET-RIRNTOMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella luteorostrata (ncbitaxon:1105319) | - | DOI (10.1016/j.tetlet.2011.10.020) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luteoride A (CHEBI:210741) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl (2Z)-2-hydroxyimino-3-[7-[(1E)-3-methylbuta-1,3-dienyl]-1H-indol-3-yl]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 78435104 | ChemSpider |