EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O6 |
| Net Charge | 0 |
| Average Mass | 304.298 |
| Monoisotopic Mass | 304.09469 |
| SMILES | COc1cc(C)c(O)c2c1Oc1c(c(C)cc(O)c1OC)O2 |
| InChI | InChI=1S/C16H16O6/c1-7-6-10(19-3)14-15(11(7)18)21-12-8(2)5-9(17)13(20-4)16(12)22-14/h5-6,17-18H,1-4H3 |
| InChIKey | OENVHRUXDBVVAO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (24443433) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6-dimethoxy-2,9-dimethyldibenzo[b,e][1,4]dioxine-1,7-diol (CHEBI:210628) is a dibenzodioxine (CHEBI:23825) |
| IUPAC Name |
|---|
| 4,6-dimethoxy-2,9-dimethyldibenzo-p-dioxin-1,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 32674877 | ChemSpider |