EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H58N8O12S2 |
| Net Charge | 0 |
| Average Mass | 847.027 |
| Monoisotopic Mass | 846.36156 |
| SMILES | CCCCCCCC[C@@H]1NC(=O)[C@H](CC(O)C(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCC(=O)OC(=O)[C@@H]2CSSC[C@H](NC1=O)C(=O)N2 |
| InChI | InChI=1S/C35H58N8O12S2/c1-4-5-6-7-8-9-10-20-30(49)42-24-16-56-57-17-25(43-34(24)53)35(54)55-27(46)12-11-19(36)29(48)39-21(13-18(2)3)31(50)41-23(15-44)33(52)40-22(32(51)38-20)14-26(45)28(37)47/h18-26,44-45H,4-17,36H2,1-3H3,(H2,37,47)(H,38,51)(H,39,48)(H,40,52)(H,41,50)(H,42,49)(H,43,53)/t19-,20-,21-,22-,23-,24-,25-,26?/m0/s1 |
| InChIKey | CZXJCEODNNZLBX-BYBKDHMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium graminearum (ncbitaxon:5518) | - | PubMed (30395461) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gramillin A (CHEBI:210611) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 3-[(1R,4S,7S,10S,13S,16S,22R)-16-amino-10-(hydroxymethyl)-13-(2-methylpropyl)-4-octyl-3,6,9,12,15,19,21,27-octaoxo-20-oxa-24,25-dithia-2,5,8,11,14,28-hexazabicyclo[20.4.2]octacosan-7-yl]-2-hydroxypropanamide |
| Manual Xrefs | Databases |
|---|---|
| 78440595 | ChemSpider |