EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O6 |
| Net Charge | 0 |
| Average Mass | 420.546 |
| Monoisotopic Mass | 420.25119 |
| SMILES | CC(=O)O[C@H]1[C@@H](O)[C@@H]2[C@H]3OCC4=C3[C@@](C)(CC[C@@H]4OC(C)=O)CC[C@]2(C)[C@H]1C(C)C |
| InChI | InChI=1S/C24H36O6/c1-12(2)17-22(30-14(4)26)20(27)19-21-18-15(11-28-21)16(29-13(3)25)7-8-23(18,5)9-10-24(17,19)6/h12,16-17,19-22,27H,7-11H2,1-6H3/t16-,17-,19+,20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | QKQWYCCVHVFKEM-WADRPXCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Verticillium dahliae (ncbitaxon:27337) | - | PubMed (30659876) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dahliane H (CHEBI:210605) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(1R,2R,3S,4R,5R,6R,9R,12S)-4-acetyloxy-3-hydroxy-6,9-dimethyl-5-propan-2-yl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadec-13(16)-en-12-yl] acetate |