EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29ClN2O2 |
| Net Charge | 0 |
| Average Mass | 436.983 |
| Monoisotopic Mass | 436.19176 |
| SMILES | [C-]#[N+][C@@]12[C@@](C)(C=C)[C@H](Cl)C[C@@H]3C(C)(C)c4cccc5nc(c(c45)[C@]31O)C(C)(C)[C@]21CO1 |
| InChI | InChI=1S/C26H29ClN2O2/c1-8-23(6)17(27)12-16-21(2,3)14-10-9-11-15-18(14)19-20(29-15)22(4,5)24(13-31-24)26(23,28-7)25(16,19)30/h8-11,16-17,29-30H,1,12-13H2,2-6H3/t16-,17-,23+,24-,25-,26-/m1/s1 |
| InChIKey | KJUYAVAQJZRMGD-BNGQEVPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerella ambigua UTEX 1903 (ncbitaxon:230521) | - | PubMed (20965528) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fischambiguine B (CHEBI:210599) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (9R,10S,11R,12R,14R,15R)-12-chloro-11-ethenyl-10-isocyano-8,8,11,18,18-pentamethylspiro[6-azapentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16)-tetraene-9,2'-oxirane]-15-ol |
| Manual Xrefs | Databases |
|---|---|
| 34501440 | ChemSpider |