EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O8 |
| Net Charge | 0 |
| Average Mass | 504.620 |
| Monoisotopic Mass | 504.27232 |
| SMILES | CC(O)(CC(=O)O)CC(=O)OCC1=C[C@@]2(O)[C@H](C[C@@H]3[C@@]4(C)CCCC(C)(C)[C@@H]4CC[C@@]32C)C(=O)C1=O |
| InChI | InChI=1S/C28H40O8/c1-24(2)8-6-9-26(4)18(24)7-10-27(5)19(26)11-17-23(33)22(32)16(12-28(17,27)35)15-36-21(31)14-25(3,34)13-20(29)30/h12,17-19,34-35H,6-11,13-15H2,1-5H3,(H,29,30)/t17-,18+,19-,25?,26+,27+,28-/m1/s1 |
| InChIKey | VBYFVFMZJVTSHX-YHKOIMIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dasyscyphus (ncbitaxon:318839) | - | DOI (10.1016/j.tet.2005.11.041) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dasyscyphin C (CHEBI:210583) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| 5-[[(4aS,6aS,6bR,10aS,11aR,11bS)-6b-hydroxy-4,4,6a,11b-tetramethyl-9,10-dioxo-2,3,4a,5,6,10a,11,11a-octahydro-1H-benzo[a]luoren-8-yl]methoxy]-3-hydroxy-3-methyl-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9737232 | ChemSpider |