EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O4 |
| Net Charge | 0 |
| Average Mass | 254.326 |
| Monoisotopic Mass | 254.15181 |
| SMILES | CCCC[C@@H](O)C#C[C@@H](O)/C=C\CCCC(=O)O |
| InChI | InChI=1S/C14H22O4/c1-2-3-7-12(15)10-11-13(16)8-5-4-6-9-14(17)18/h5,8,12-13,15-16H,2-4,6-7,9H2,1H3,(H,17,18)/b8-5-/t12-,13+/m1/s1 |
| InChIKey | WSAOFJBMEVAKDJ-ODBCZPJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coriolopsis gallica (ncbitaxon:76126) | - | PubMed (18247526) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gallicynoic acid A (CHEBI:210572) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (Z,7S,10R)-7,10-dihydroxytetradec-5-en-8-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28284927 | ChemSpider |