EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C(O)=C3[C@](C)(CO)CC=C[C@]3(C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C20H26O4/c1-5-17(2)9-10-20(24)13(11-17)14(22)15(23)16-18(3,12-21)7-6-8-19(16,20)4/h5-6,8,11,21,23-24H,1,7,9-10,12H2,2-4H3/t17-,18-,19-,20+/m0/s1 |
| InChIKey | LFRSXNQOAUFLLU-LWYYNNOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Libertellaspecies (ncbitaxon:2040850) | - | PubMed (15993608) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Libertellenone B (CHEBI:210545) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,4aS,4bS,7R)-7-ethenyl-4b,10-dihydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-5,6-dihydro-2H-phenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 10480843 | ChemSpider |