EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O2 |
| Net Charge | 0 |
| Average Mass | 284.399 |
| Monoisotopic Mass | 284.17763 |
| SMILES | C=C[C@@]1(C)CCc2c3c(cc(O)c2C1=O)C(C)(C)CCC3 |
| InChI | InChI=1S/C19H24O2/c1-5-19(4)10-8-13-12-7-6-9-18(2,3)14(12)11-15(20)16(13)17(19)21/h5,11,20H,1,6-10H2,2-4H3/t19-/m0/s1 |
| InChIKey | WENUQQQZXYZRPA-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus wentii (ncbitaxon:5066) | - | PubMed (24499164) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspewentin B (CHEBI:210543) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (2R)-2-ethenyl-10-hydroxy-2,8,8-trimethyl-4,5,6,7-tetrahydro-3H-phenanthren-1-one |
| Manual Xrefs | Databases |
|---|---|
| 32674718 | ChemSpider |