EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43N9O7 |
| Net Charge | 0 |
| Average Mass | 605.697 |
| Monoisotopic Mass | 605.32854 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CCCNC(N)=O)NC(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(=O)NC(C=O)CCCN=C(N)N |
| InChI | InChI=1S/C27H43N9O7/c1-16(2)21(23(39)33-18(15-37)10-6-12-31-25(28)29)36-22(38)19(11-7-13-32-26(30)42)34-27(43)35-20(24(40)41)14-17-8-4-3-5-9-17/h3-5,8-9,15-16,18-21H,6-7,10-14H2,1-2H3,(H,33,39)(H,36,38)(H,40,41)(H4,28,29,31)(H3,30,32,42)(H2,34,35,43)/t18?,19-,20-,21-/m0/s1 |
| InChIKey | BSQUDBCOAFMVDB-KTYMLHDXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (27797509) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deimino-antipain (CHEBI:210502) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-5-(carbamoylamino)-1-[[(2S)-1-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]carbamoylamino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440582 | ChemSpider |