EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NO4 |
| Net Charge | 0 |
| Average Mass | 365.429 |
| Monoisotopic Mass | 365.16271 |
| SMILES | NC(=O)/C=C/C=C/C1C=CC2C=CC3OC(/C=C/C=C/C=C/C(=O)O)C1C23 |
| InChI | InChI=1S/C22H23NO4/c23-19(24)9-6-5-7-15-11-12-16-13-14-18-22(16)21(15)17(27-18)8-3-1-2-4-10-20(25)26/h1-18,21-22H,(H2,23,24)(H,25,26)/b2-1+,7-5+,8-3+,9-6+,10-4+ |
| InChIKey | AQEGYTZKJNBFQS-KIMWIMGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (27447056) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metatricycloene (CHEBI:210496) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-[10-[(1E,3E)-5-amino-5-oxopenta-1,3-dienyl]-3-oxatricyclo[5.3.1.04,11]undeca-5,8-dien-2-yl]hepta-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78444607 | ChemSpider |