EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O4 |
| Net Charge | 0 |
| Average Mass | 348.398 |
| Monoisotopic Mass | 348.13616 |
| SMILES | C/C=C/C=C/[C@@H]1OC(=O)c2cc(C(=O)O)cc(-c3ccccc3)c2[C@@H]1C |
| InChI | InChI=1S/C22H20O4/c1-3-4-6-11-19-14(2)20-17(15-9-7-5-8-10-15)12-16(21(23)24)13-18(20)22(25)26-19/h3-14,19H,1-2H3,(H,23,24)/b4-3+,11-6+/t14-,19+/m1/s1 |
| InChIKey | DAMIYZRHNWHJME-RIFTUHMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraconiothyrium (ncbitaxon:300251) | - | PubMed (30496810) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Paralactonic acid E (CHEBI:210474) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| (3S,4S)-4-methyl-1-oxo-3-[(1E,3E)-penta-1,3-dienyl]-5-phenyl-3,4-dihydroisochromene-7-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 71116008 | ChemSpider |