EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H51N5O6S |
| Net Charge | 0 |
| Average Mass | 681.900 |
| Monoisotopic Mass | 681.35601 |
| SMILES | C=CC(C)(C)N(C(Cc1ccc(O)cc1)C(=O)NC(C(=O)N1CCCC1C(=O)N1CCCC1c1nc(C(=O)O)cs1)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H51N5O6S/c1-9-36(7,8)41(35(4,5)6)28(20-23-14-16-24(42)17-15-23)30(43)38-29(22(2)3)33(45)40-19-11-13-27(40)32(44)39-18-10-12-26(39)31-37-25(21-48-31)34(46)47/h9,14-17,21-22,26-29,42H,1,10-13,18-20H2,2-8H3,(H,38,43)(H,46,47) |
| InChIKey | OIUDOESTZZFCMT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Limnoraphisspecies CCNP1324 (ncbitaxon:2854020) | - | PubMed (32867236) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosamide 693 (CHEBI:210471) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 2-[1-[1-[2-[[2-[tert-butyl(2-methylbut-3-en-2-yl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylic acid |