EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H45N5O5S |
| Net Charge | 0 |
| Average Mass | 671.864 |
| Monoisotopic Mass | 671.31414 |
| SMILES | C=CC(C)(C)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)N1CCCC1c1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C37H45N5O5S/c1-5-37(2,3)40-27(22-25-14-8-6-9-15-25)32(43)38-28(23-26-16-10-7-11-17-26)34(44)42-21-13-19-31(42)35(45)41-20-12-18-30(41)33-39-29(24-48-33)36(46)47-4/h5-11,14-17,24,27-28,30-31,40H,1,12-13,18-23H2,2-4H3,(H,38,43) |
| InChIKey | IIMKUAKIRYOISV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Limnoraphisspecies CCNP1324 (ncbitaxon:2854020) | - | PubMed (32867236) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosamide 671 (CHEBI:210459) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| methyl 2-[1-[1-[2-[[2-(2-methylbut-3-en-2-ylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 92169410 | ChemSpider |