EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N4O9 |
| Net Charge | 0 |
| Average Mass | 554.556 |
| Monoisotopic Mass | 554.20128 |
| SMILES | C[C@H]1OC(c2ccccc2O)=N[C@@H]1C(=O)N[C@H](CCCN(O)C(=O)[C@H]1N=C(c2ccccc2O)O[C@@H]1C)C(=O)O |
| InChI | InChI=1S/C27H30N4O9/c1-14-21(29-24(39-14)16-8-3-5-11-19(16)32)23(34)28-18(27(36)37)10-7-13-31(38)26(35)22-15(2)40-25(30-22)17-9-4-6-12-20(17)33/h3-6,8-9,11-12,14-15,18,21-22,32-33,38H,7,10,13H2,1-2H3,(H,28,34)(H,36,37)/t14-,15-,18-,21+,22+/m1/s1 |
| InChIKey | LDZQYJVRAADCDV-BUKMRGBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catenuloplanes (ncbitaxon:33874) | - | PubMed (30130105) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Catenulobactin B (CHEBI:210455) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-5-[hydroxy-[(4S,5R)-2-(2-hydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]-2-[[(4S,5R)-2-(2-hydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439143 | ChemSpider |