EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H45N5O6S |
| Net Charge | 0 |
| Average Mass | 639.819 |
| Monoisotopic Mass | 639.30906 |
| SMILES | C=CC(C)(C)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)N1CCCC1C(=O)N1CCCC1c1nc(C(=O)OC)cs1)C(C)C |
| InChI | InChI=1S/C33H45N5O6S/c1-7-33(4,5)36-23(18-21-12-14-22(39)15-13-21)28(40)35-27(20(2)3)31(42)38-17-9-11-26(38)30(41)37-16-8-10-25(37)29-34-24(19-45-29)32(43)44-6/h7,12-15,19-20,23,25-27,36,39H,1,8-11,16-18H2,2-6H3,(H,35,40) |
| InChIKey | SGQDBLJQURGTKN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Limnoraphisspecies CCNP1324 (ncbitaxon:2854020) | - | PubMed (32867236) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosamide 639 (CHEBI:210453) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| methyl 2-[1-[1-[2-[[3-(4-hydroxyphenyl)-2-(2-methylbut-3-en-2-ylamino)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |