EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO2 |
| Net Charge | 0 |
| Average Mass | 115.132 |
| Monoisotopic Mass | 115.06333 |
| SMILES | CC1(C)N[C@@H]1C(=O)O |
| InChI | InChI=1S/C5H9NO2/c1-5(2)3(6-5)4(7)8/h3,6H,1-2H3,(H,7,8)/t3-/m1/s1 |
| InChIKey | LQNRQHXPYZSWHH-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pleurocybella porrigens (ncbitaxon:71910) | - | DOI (10.1002/ange.201004646) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pleurocybellaziridin (CHEBI:210424) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-3,3-dimethylaziridine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442764 | ChemSpider |