EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:210420 - 3-(3-Chloro-4-hydroxyphenyl)propionic acid
| Formula | C9H9ClO3 |
| Net Charge | 0 |
| Average Mass | 200.621 |
| Monoisotopic Mass | 200.02402 |
| SMILES | O=C(O)CCc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClO3/c10-7-5-6(1-3-8(7)11)2-4-9(12)13/h1,3,5,11H,2,4H2,(H,12,13) |
| InChIKey | WCFMGDDKGCCBRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32867397) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3-Chloro-4-hydroxyphenyl)propionic acid (CHEBI:210420) is a benzenes (CHEBI:22712) |
| 3-(3-Chloro-4-hydroxyphenyl)propionic acid (CHEBI:210420) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(3-chloro-4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 25910983 | ChemSpider |