EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O8 |
| Net Charge | 0 |
| Average Mass | 210.138 |
| Monoisotopic Mass | 210.03757 |
| SMILES | [H][C@@](O)([C@@]([H])(O)[C@]([H])(O)C(=O)O)[C@]([H])(O)C(=O)O |
| WURCS | WURCS=2.0/1,1,0/[A1212A]/1/ |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3+,4+/m1/s1 |
| InChIKey | DSLZVSRJTYRBFB-MMPJQOAZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-idaric acid (CHEBI:21041) is a idaric acid (CHEBI:24765) |
| D-idaric acid (CHEBI:21041) is conjugate acid of D-idarate(1−) (CHEBI:35386) |
| D-idaric acid (CHEBI:21041) is enantiomer of L-idaric acid (CHEBI:21333) |
| Incoming Relation(s) |
| D-idarate(1−) (CHEBI:35386) is conjugate base of D-idaric acid (CHEBI:21041) |
| L-idaric acid (CHEBI:21333) is enantiomer of D-idaric acid (CHEBI:21041) |
| IUPAC Name |
|---|
| D-idaric acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728119 | Reaxys |