EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O4 |
| Net Charge | 0 |
| Average Mass | 302.370 |
| Monoisotopic Mass | 302.15181 |
| SMILES | C/C=C/CC[C@@H]1Cc2cc(O)c(C/C=C/C)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H22O4/c1-3-5-7-8-13-10-12-11-15(19)14(9-6-4-2)17(20)16(12)18(21)22-13/h3-6,11,13,19-20H,7-10H2,1-2H3/b5-3+,6-4+/t13-/m1/s1 |
| InChIKey | VDHJVLMLBFZNRU-ORQLPXSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Geotrichumspecies (ncbitaxon:1907943) | - | PubMed (12762815) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-but-15-enyl-6,8-dihydroxy-3(R)-pent-11-enylisochroman-1-one (CHEBI:210408) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-7-[(E)-but-2-enyl]-6,8-dihydroxy-3-[(E)-pent-3-enyl]-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 9110783 | ChemSpider |