EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O5 |
| Net Charge | 0 |
| Average Mass | 294.347 |
| Monoisotopic Mass | 294.14672 |
| SMILES | Cc1c(O)c(C)c2c(c1O)C(=O)O[C@@H](CCCC(C)O)C2 |
| InChI | InChI=1S/C16H22O5/c1-8(17)5-4-6-11-7-12-9(2)14(18)10(3)15(19)13(12)16(20)21-11/h8,11,17-19H,4-7H2,1-3H3/t8?,11-/m0/s1 |
| InChIKey | OHHXALPTLPRFKQ-LYNSQETBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:5455) | - | PubMed (26182330) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colletomellein B (CHEBI:210373) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S)-6,8-dihydroxy-3-(4-hydroxypentyl)-5,7-dimethyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78441097 | ChemSpider |