EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O4S |
| Net Charge | 0 |
| Average Mass | 308.359 |
| Monoisotopic Mass | 308.08308 |
| SMILES | CS[C@]1(CO)C(=O)N2c3c(O)cccc3CC2C(=O)N1C |
| InChI | InChI=1S/C14H16N2O4S/c1-15-12(19)9-6-8-4-3-5-10(18)11(8)16(9)13(20)14(15,7-17)21-2/h3-5,9,17-18H,6-7H2,1-2H3/t9?,14-/m1/s1 |
| InChIKey | HLTTVBPDCRSKFJ-IWSPRGBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum gloeosporioides (ncbitaxon:474922) | - | PubMed (20541231) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colletopiperazine (CHEBI:210337) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (3R)-6-hydroxy-3-(hydroxymethyl)-2-methyl-3-methylsulanyl-10,10a-dihydropyrazino[1,2-a]indole-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78442625 | ChemSpider |